C10H9F6NO2S — CID 63226683
4-(trifluoromethylsulfonyl)-N-(3,3,3-trifluoropropyl)aniline (PubChem CID 63226683) has the molecular formula C10H9F6NO2S and a molecular weight of 321.24 g/mol. Its IUPAC name is 4-(trifluoromethylsulfonyl)-N-(3,3,3-trifluoropropyl)aniline.
| Compound Name | 4-(trifluoromethylsulfonyl)-N-(3,3,3-trifluoropropyl)aniline |
|---|---|
| PubChem CID | 63226683 |
| Molecular Formula | C10H9F6NO2S |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 4-(trifluoromethylsulfonyl)-N-(3,3,3-trifluoropropyl)aniline |
| SMILES | O=S(=O)(c1ccc(NCCC(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H9F6NO2S/c11-9(12,13)5-6-17-7-1-3-8(4-2-7)20(18,19)10(14,15)16/h1-4,17H,5-6H2 |
| InChIKey | QUVQRZUXXSMCND-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |