C12H16F3NO2S2 — CID 115663481
N-(2-methyl-2-methylsulfanylpropyl)-4-(trifluoromethylsulfonyl)aniline (PubChem CID 115663481) has the molecular formula C12H16F3NO2S2 and a molecular weight of 327.39 g/mol. Its IUPAC name is N-(2-methyl-2-methylsulfanylpropyl)-4-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-(2-methyl-2-methylsulfanylpropyl)-4-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 115663481 |
| Molecular Formula | C12H16F3NO2S2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-(2-methyl-2-methylsulfanylpropyl)-4-(trifluoromethylsulfonyl)aniline |
| SMILES | CSC(C)(C)CNc1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H16F3NO2S2/c1-11(2,19-3)8-16-9-4-6-10(7-5-9)20(17,18)12(13,14)15/h4-7,16H,8H2,1-3H3 |
| InChIKey | LQCUYTGNENWYPH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |