C10H10F3NO4S — CID 43427641
methyl 2-[4-(trifluoromethylsulfonyl)anilino]acetate (PubChem CID 43427641) has the molecular formula C10H10F3NO4S and a molecular weight of 297.25 g/mol. Its IUPAC name is methyl 2-[4-(trifluoromethylsulfonyl)anilino]acetate.
| Compound Name | methyl 2-[4-(trifluoromethylsulfonyl)anilino]acetate |
|---|---|
| PubChem CID | 43427641 |
| Molecular Formula | C10H10F3NO4S |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | methyl 2-[4-(trifluoromethylsulfonyl)anilino]acetate |
| SMILES | COC(=O)CNc1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NO4S/c1-18-9(15)6-14-7-2-4-8(5-3-7)19(16,17)10(11,12)13/h2-5,14H,6H2,1H3 |
| InChIKey | DEPFKVUFVOSXDZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |