C12H13F3N2O3S — CID 43429869
N-cyclopropyl-2-[4-(trifluoromethylsulfonyl)anilino]acetamide (PubChem CID 43429869) has the molecular formula C12H13F3N2O3S and a molecular weight of 322.31 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-(trifluoromethylsulfonyl)anilino]acetamide.
| Compound Name | N-cyclopropyl-2-[4-(trifluoromethylsulfonyl)anilino]acetamide |
|---|---|
| PubChem CID | 43429869 |
| Molecular Formula | C12H13F3N2O3S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-cyclopropyl-2-[4-(trifluoromethylsulfonyl)anilino]acetamide |
| SMILES | O=C(CNc1ccc(S(=O)(=O)C(F)(F)F)cc1)NC1CC1 |
| InChI | InChI=1S/C12H13F3N2O3S/c13-12(14,15)21(19,20)10-5-3-8(4-6-10)16-7-11(18)17-9-1-2-9/h3-6,9,16H,1-2,7H2,(H,17,18) |
| InChIKey | KZPJWZZLILEERL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |