C13H18F3NO3S — CID 61247174
4-methyl-2-[4-(trifluoromethylsulfonyl)anilino]pentan-1-ol (PubChem CID 61247174) has the molecular formula C13H18F3NO3S and a molecular weight of 325.35 g/mol. Its IUPAC name is 4-methyl-2-[4-(trifluoromethylsulfonyl)anilino]pentan-1-ol.
| Compound Name | 4-methyl-2-[4-(trifluoromethylsulfonyl)anilino]pentan-1-ol |
|---|---|
| PubChem CID | 61247174 |
| Molecular Formula | C13H18F3NO3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-methyl-2-[4-(trifluoromethylsulfonyl)anilino]pentan-1-ol |
| SMILES | CC(C)CC(CO)Nc1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NO3S/c1-9(2)7-11(8-18)17-10-3-5-12(6-4-10)21(19,20)13(14,15)16/h3-6,9,11,17-18H,7-8H2,1-2H3 |
| InChIKey | OZSQIDKZDPIRPP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |