C10H15NO2S — CID 76891537
3-(3-methylsulfanylanilino)propane-1,2-diol (PubChem CID 76891537) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 3-(3-methylsulfanylanilino)propane-1,2-diol.
| Compound Name | 3-(3-methylsulfanylanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 76891537 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 3-(3-methylsulfanylanilino)propane-1,2-diol |
| SMILES | CSc1cccc(NCC(O)CO)c1 |
| InChI | InChI=1S/C10H15NO2S/c1-14-10-4-2-3-8(5-10)11-6-9(13)7-12/h2-5,9,11-13H,6-7H2,1H3 |
| InChIKey | PPZNWHHVCSLPMB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |