C15H20N2O2 — CID 168593844
3-[3-(2,5-dimethylpyrrol-1-yl)anilino]propane-1,2-diol (PubChem CID 168593844) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-[3-(2,5-dimethylpyrrol-1-yl)anilino]propane-1,2-diol.
| Compound Name | 3-[3-(2,5-dimethylpyrrol-1-yl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168593844 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 3-[3-(2,5-dimethylpyrrol-1-yl)anilino]propane-1,2-diol |
| SMILES | Cc1ccc(C)n1-c1cccc(NCC(O)CO)c1 |
| InChI | InChI=1S/C15H20N2O2/c1-11-6-7-12(2)17(11)14-5-3-4-13(8-14)16-9-15(19)10-18/h3-8,15-16,18-19H,9-10H2,1-2H3 |
| InChIKey | BIQDKDXHVHGNHR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|