C16H19NO2 — CID 168596529
3-[3-(2-methylphenyl)anilino]propane-1,2-diol (PubChem CID 168596529) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-[3-(2-methylphenyl)anilino]propane-1,2-diol.
| Compound Name | 3-[3-(2-methylphenyl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168596529 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-[3-(2-methylphenyl)anilino]propane-1,2-diol |
| SMILES | Cc1ccccc1-c1cccc(NCC(O)CO)c1 |
| InChI | InChI=1S/C16H19NO2/c1-12-5-2-3-8-16(12)13-6-4-7-14(9-13)17-10-15(19)11-18/h2-9,15,17-19H,10-11H2,1H3 |
| InChIKey | ZEAYKYMWQNGDJK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |