C16H16N2O2S — CID 168597036
3-[3-(1,3-benzothiazol-2-yl)anilino]propane-1,2-diol (PubChem CID 168597036) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 3-[3-(1,3-benzothiazol-2-yl)anilino]propane-1,2-diol.
| Compound Name | 3-[3-(1,3-benzothiazol-2-yl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168597036 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 3-[3-(1,3-benzothiazol-2-yl)anilino]propane-1,2-diol |
| SMILES | OCC(O)CNc1cccc(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C16H16N2O2S/c19-10-13(20)9-17-12-5-3-4-11(8-12)16-18-14-6-1-2-7-15(14)21-16/h1-8,13,17,19-20H,9-10H2 |
| InChIKey | AZOMTSZCUXMXJO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |