About N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline
N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline (PubChem CID 90070811) has the molecular formula C22H15N3S2
and a molecular weight of 385.52 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline.
Molecular Properties
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline |
| PubChem CID | 90070811 |
| Molecular Formula | C22H15N3S2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline |
| SMILES | c1cc(Nc2cccc(-c3nc4ccccc4s3)c2)cc(-c2nccs2)c1 |
| InChI | InChI=1S/C22H15N3S2/c1-2-10-20-19(9-1)25-22(27-20)16-6-4-8-18(14-16)24-17-7-3-5-15(13-17)21-23-11-12-26-21/h1-14,24H |
| InChIKey | DNGMASMJAAAHAL-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline?
The IUPAC name of N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline (CID 90070811) is N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline.
What is the SMILES notation for N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline?
The canonical SMILES for N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline is c1cc(Nc2cccc(-c3nc4ccccc4s3)c2)cc(-c2nccs2)c1.
What is the InChIKey of N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline?
The InChIKey is DNGMASMJAAAHAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15N3S2/c1-2-10-20-19(9-1)25-22(27-20)16-6-4-8-18(14-16)24-17-7-3-5-15(13-17)21-23-11-12-26-21/h1-14,24H.
What are the key properties of N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline?
N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline has a molecular weight of 385.52 g/mol, XLogP of 6.83, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline is sourced from PubChem (CID 90070811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).