C22H15N3S2 — CID 90070811
N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline (PubChem CID 90070811) has the molecular formula C22H15N3S2 and a molecular weight of 385.52 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 90070811 |
| Molecular Formula | C22H15N3S2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-thiazol-2-yl)aniline |
| SMILES | c1cc(Nc2cccc(-c3nc4ccccc4s3)c2)cc(-c2nccs2)c1 |
| InChI | InChI=1S/C22H15N3S2/c1-2-10-20-19(9-1)25-22(27-20)16-6-4-8-18(14-16)24-17-7-3-5-15(13-17)21-23-11-12-26-21/h1-14,24H |
| InChIKey | DNGMASMJAAAHAL-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |