C12H16N2S — CID 143181511
ethane;N-methyl-3-(1,3-thiazol-2-yl)aniline (PubChem CID 143181511) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is ethane;N-methyl-3-(1,3-thiazol-2-yl)aniline.
| Compound Name | ethane;N-methyl-3-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 143181511 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | ethane;N-methyl-3-(1,3-thiazol-2-yl)aniline |
| SMILES | CC.CNc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C10H10N2S.C2H6/c1-11-9-4-2-3-8(7-9)10-12-5-6-13-10;1-2/h2-7,11H,1H3;1-2H3 |
| InChIKey | YGPJZBQWNVIFDW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |