C15H20N2S — CID 54864648
N-hexan-2-yl-3-(1,3-thiazol-2-yl)aniline (PubChem CID 54864648) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is N-hexan-2-yl-3-(1,3-thiazol-2-yl)aniline.
| Compound Name | N-hexan-2-yl-3-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 54864648 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-hexan-2-yl-3-(1,3-thiazol-2-yl)aniline |
| SMILES | CCCCC(C)Nc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C15H20N2S/c1-3-4-6-12(2)17-14-8-5-7-13(11-14)15-16-9-10-18-15/h5,7-12,17H,3-4,6H2,1-2H3 |
| InChIKey | ALLFSXYEWOUDQA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |