C14H14N4S — CID 54881716
N-[1-(1H-pyrazol-5-yl)ethyl]-3-(1,3-thiazol-2-yl)aniline (PubChem CID 54881716) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is N-[1-(1H-pyrazol-5-yl)ethyl]-3-(1,3-thiazol-2-yl)aniline.
| Compound Name | N-[1-(1H-pyrazol-5-yl)ethyl]-3-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 54881716 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-[1-(1H-pyrazol-5-yl)ethyl]-3-(1,3-thiazol-2-yl)aniline |
| SMILES | CC(Nc1cccc(-c2nccs2)c1)c1ccn[nH]1 |
| InChI | InChI=1S/C14H14N4S/c1-10(13-5-6-16-18-13)17-12-4-2-3-11(9-12)14-15-7-8-19-14/h2-10,17H,1H3,(H,16,18) |
| InChIKey | OSQAEJRPUZHQQG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |