C16H22N2S — CID 55193873
N-heptan-4-yl-3-(1,3-thiazol-2-yl)aniline (PubChem CID 55193873) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is N-heptan-4-yl-3-(1,3-thiazol-2-yl)aniline.
| Compound Name | N-heptan-4-yl-3-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 55193873 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N-heptan-4-yl-3-(1,3-thiazol-2-yl)aniline |
| SMILES | CCCC(CCC)Nc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C16H22N2S/c1-3-6-14(7-4-2)18-15-9-5-8-13(12-15)16-17-10-11-19-16/h5,8-12,14,18H,3-4,6-7H2,1-2H3 |
| InChIKey | JAVGSBJKJQRDJF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |