C14H18N2S2 — CID 113373272
N-(3-ethylsulfanylpropyl)-3-(1,3-thiazol-2-yl)aniline (PubChem CID 113373272) has the molecular formula C14H18N2S2 and a molecular weight of 278.45 g/mol. Its IUPAC name is N-(3-ethylsulfanylpropyl)-3-(1,3-thiazol-2-yl)aniline.
| Compound Name | N-(3-ethylsulfanylpropyl)-3-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 113373272 |
| Molecular Formula | C14H18N2S2 |
| Molecular Weight | 278.45 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-(3-ethylsulfanylpropyl)-3-(1,3-thiazol-2-yl)aniline |
| SMILES | CCSCCCNc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C14H18N2S2/c1-2-17-9-4-7-15-13-6-3-5-12(11-13)14-16-8-10-18-14/h3,5-6,8,10-11,15H,2,4,7,9H2,1H3 |
| InChIKey | YIHWBTCZLNLZGK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|