C13H18N4S — CID 113373299
N-(3-ethylsulfanylpropyl)-3-(1,2,4-triazol-4-yl)aniline (PubChem CID 113373299) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is N-(3-ethylsulfanylpropyl)-3-(1,2,4-triazol-4-yl)aniline.
| Compound Name | N-(3-ethylsulfanylpropyl)-3-(1,2,4-triazol-4-yl)aniline |
|---|---|
| PubChem CID | 113373299 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(3-ethylsulfanylpropyl)-3-(1,2,4-triazol-4-yl)aniline |
| SMILES | CCSCCCNc1cccc(-n2cnnc2)c1 |
| InChI | InChI=1S/C13H18N4S/c1-2-18-8-4-7-14-12-5-3-6-13(9-12)17-10-15-16-11-17/h3,5-6,9-11,14H,2,4,7-8H2,1H3 |
| InChIKey | WTOKARDSSJFSIQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|