C13H18N4 — CID 43691893
N-pentyl-3-(1,2,4-triazol-4-yl)aniline (PubChem CID 43691893) has the molecular formula C13H18N4 and a molecular weight of 230.32 g/mol. Its IUPAC name is N-pentyl-3-(1,2,4-triazol-4-yl)aniline.
| Compound Name | N-pentyl-3-(1,2,4-triazol-4-yl)aniline |
|---|---|
| PubChem CID | 43691893 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.32 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N-pentyl-3-(1,2,4-triazol-4-yl)aniline |
| SMILES | CCCCCNc1cccc(-n2cnnc2)c1 |
| InChI | InChI=1S/C13H18N4/c1-2-3-4-8-14-12-6-5-7-13(9-12)17-10-15-16-11-17/h5-7,9-11,14H,2-4,8H2,1H3 |
| InChIKey | UWZVIAKSVVXCSY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|