C16H16N4O — CID 43691927
N-[(3-methoxyphenyl)methyl]-3-(1,2,4-triazol-4-yl)aniline (PubChem CID 43691927) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-3-(1,2,4-triazol-4-yl)aniline.
| Compound Name | N-[(3-methoxyphenyl)methyl]-3-(1,2,4-triazol-4-yl)aniline |
|---|---|
| PubChem CID | 43691927 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-3-(1,2,4-triazol-4-yl)aniline |
| SMILES | COc1cccc(CNc2cccc(-n3cnnc3)c2)c1 |
| InChI | InChI=1S/C16H16N4O/c1-21-16-7-2-4-13(8-16)10-17-14-5-3-6-15(9-14)20-11-18-19-12-20/h2-9,11-12,17H,10H2,1H3 |
| InChIKey | PEAWYLBKKZDRMO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |