C15H14N4O2 — CID 43691958
4-[[3-(1,2,4-triazol-4-yl)anilino]methyl]benzene-1,2-diol (PubChem CID 43691958) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-[[3-(1,2,4-triazol-4-yl)anilino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[3-(1,2,4-triazol-4-yl)anilino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 43691958 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4-[[3-(1,2,4-triazol-4-yl)anilino]methyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CNc2cccc(-n3cnnc3)c2)cc1O |
| InChI | InChI=1S/C15H14N4O2/c20-14-5-4-11(6-15(14)21)8-16-12-2-1-3-13(7-12)19-9-17-18-10-19/h1-7,9-10,16,20-21H,8H2 |
| InChIKey | NNDISHMEMVCVMI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|