C12H14N4 — CID 43692027
N-(cyclopropylmethyl)-3-(1,2,4-triazol-4-yl)aniline (PubChem CID 43692027) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3-(1,2,4-triazol-4-yl)aniline.
| Compound Name | N-(cyclopropylmethyl)-3-(1,2,4-triazol-4-yl)aniline |
|---|---|
| PubChem CID | 43692027 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | N-(cyclopropylmethyl)-3-(1,2,4-triazol-4-yl)aniline |
| SMILES | c1cc(NCC2CC2)cc(-n2cnnc2)c1 |
| InChI | InChI=1S/C12H14N4/c1-2-11(13-7-10-4-5-10)6-12(3-1)16-8-14-15-9-16/h1-3,6,8-10,13H,4-5,7H2 |
| InChIKey | PRLQFRMCMNTXEC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |