About N-(3-methylbutyl)-3-(1,2,4-triazol-4-yl)aniline
N-(3-methylbutyl)-3-(1,2,4-triazol-4-yl)aniline (PubChem CID 43691963) has the molecular formula C13H18N4
and a molecular weight of 230.31 g/mol. Its IUPAC name is N-(3-methylbutyl)-3-(1,2,4-triazol-4-yl)aniline.
Molecular Properties
| Compound Name | N-(3-methylbutyl)-3-(1,2,4-triazol-4-yl)aniline |
| PubChem CID | 43691963 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N-(3-methylbutyl)-3-(1,2,4-triazol-4-yl)aniline |
| SMILES | CC(C)CCNc1cccc(-n2cnnc2)c1 |
| InChI | InChI=1S/C13H18N4/c1-11(2)6-7-14-12-4-3-5-13(8-12)17-9-15-16-10-17/h3-5,8-11,14H,6-7H2,1-2H3 |
| InChIKey | QQJGUNNLGKCJHY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-methylbutyl)-3-(1,2,4-triazol-4-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methylbutyl)-3-(1,2,4-triazol-4-yl)aniline?
The IUPAC name of N-(3-methylbutyl)-3-(1,2,4-triazol-4-yl)aniline (CID 43691963) is N-(3-methylbutyl)-3-(1,2,4-triazol-4-yl)aniline.
What is the SMILES notation for N-(3-methylbutyl)-3-(1,2,4-triazol-4-yl)aniline?
The canonical SMILES for N-(3-methylbutyl)-3-(1,2,4-triazol-4-yl)aniline is CC(C)CCNc1cccc(-n2cnnc2)c1.
What is the InChIKey of N-(3-methylbutyl)-3-(1,2,4-triazol-4-yl)aniline?
The InChIKey is QQJGUNNLGKCJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4/c1-11(2)6-7-14-12-4-3-5-13(8-12)17-9-15-16-10-17/h3-5,8-11,14H,6-7H2,1-2H3.
What are the key properties of N-(3-methylbutyl)-3-(1,2,4-triazol-4-yl)aniline?
N-(3-methylbutyl)-3-(1,2,4-triazol-4-yl)aniline has a molecular weight of 230.31 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methylbutyl)-3-(1,2,4-triazol-4-yl)aniline is sourced from PubChem (CID 43691963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).