C19H27N5OS — CID 74246190
1-cyclohexyl-1-(2-ethylsulfanylethyl)-3-[3-(1,2,4-triazol-4-yl)phenyl]urea (PubChem CID 74246190) has the molecular formula C19H27N5OS and a molecular weight of 373.53 g/mol. Its IUPAC name is 1-cyclohexyl-1-(2-ethylsulfanylethyl)-3-[3-(1,2,4-triazol-4-yl)phenyl]urea.
| Compound Name | 1-cyclohexyl-1-(2-ethylsulfanylethyl)-3-[3-(1,2,4-triazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 74246190 |
| Molecular Formula | C19H27N5OS |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 1-cyclohexyl-1-(2-ethylsulfanylethyl)-3-[3-(1,2,4-triazol-4-yl)phenyl]urea |
| SMILES | CCSCCN(C(=O)Nc1cccc(-n2cnnc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C19H27N5OS/c1-2-26-12-11-24(17-8-4-3-5-9-17)19(25)22-16-7-6-10-18(13-16)23-14-20-21-15-23/h6-7,10,13-15,17H,2-5,8-9,11-12H2,1H3,(H,22,25) |
| InChIKey | ASTGBMGDHGYAJX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|