C18H26N6O — CID 75397346
1-cyclohexyl-3-[4-methyl-3-(tetrazol-1-yl)phenyl]-1-propylurea (PubChem CID 75397346) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-methyl-3-(tetrazol-1-yl)phenyl]-1-propylurea.
| Compound Name | 1-cyclohexyl-3-[4-methyl-3-(tetrazol-1-yl)phenyl]-1-propylurea |
|---|---|
| PubChem CID | 75397346 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-cyclohexyl-3-[4-methyl-3-(tetrazol-1-yl)phenyl]-1-propylurea |
| SMILES | CCCN(C(=O)Nc1ccc(C)c(-n2cnnn2)c1)C1CCCCC1 |
| InChI | InChI=1S/C18H26N6O/c1-3-11-23(16-7-5-4-6-8-16)18(25)20-15-10-9-14(2)17(12-15)24-13-19-21-22-24/h9-10,12-13,16H,3-8,11H2,1-2H3,(H,20,25) |
| InChIKey | WLHBABQFDFLZHZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |