C11H14N6O — CID 47033827
1,1-dimethyl-3-[4-methyl-3-(tetrazol-1-yl)phenyl]urea (PubChem CID 47033827) has the molecular formula C11H14N6O and a molecular weight of 246.27 g/mol. Its IUPAC name is 1,1-dimethyl-3-[4-methyl-3-(tetrazol-1-yl)phenyl]urea.
| Compound Name | 1,1-dimethyl-3-[4-methyl-3-(tetrazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 47033827 |
| Molecular Formula | C11H14N6O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1,1-dimethyl-3-[4-methyl-3-(tetrazol-1-yl)phenyl]urea |
| SMILES | Cc1ccc(NC(=O)N(C)C)cc1-n1cnnn1 |
| InChI | InChI=1S/C11H14N6O/c1-8-4-5-9(13-11(18)16(2)3)6-10(8)17-7-12-14-15-17/h4-7H,1-3H3,(H,13,18) |
| InChIKey | SJRFORJDIKXNPB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |