C12H17ClN6O — CID 119287688
4-amino-N-[4-methyl-3-(tetrazol-1-yl)phenyl]butanamide;hydrochloride (PubChem CID 119287688) has the molecular formula C12H17ClN6O and a molecular weight of 296.76 g/mol. Its IUPAC name is 4-amino-N-[4-methyl-3-(tetrazol-1-yl)phenyl]butanamide;hydrochloride.
| Compound Name | 4-amino-N-[4-methyl-3-(tetrazol-1-yl)phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119287688 |
| Molecular Formula | C12H17ClN6O |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-amino-N-[4-methyl-3-(tetrazol-1-yl)phenyl]butanamide;hydrochloride |
| SMILES | Cc1ccc(NC(=O)CCCN)cc1-n1cnnn1.Cl |
| InChI | InChI=1S/C12H16N6O.ClH/c1-9-4-5-10(15-12(19)3-2-6-13)7-11(9)18-8-14-16-17-18;/h4-5,7-8H,2-3,6,13H2,1H3,(H,15,19);1H |
| InChIKey | UBONNEVTDWNKQO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |