C13H18N6OS — CID 61154272
(2S)-2-amino-4-methylsulfanyl-N-[4-methyl-3-(tetrazol-1-yl)phenyl]butanamide (PubChem CID 61154272) has the molecular formula C13H18N6OS and a molecular weight of 306.40 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-N-[4-methyl-3-(tetrazol-1-yl)phenyl]butanamide.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-N-[4-methyl-3-(tetrazol-1-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 61154272 |
| Molecular Formula | C13H18N6OS |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-N-[4-methyl-3-(tetrazol-1-yl)phenyl]butanamide |
| SMILES | CSCC[C@H](N)C(=O)Nc1ccc(C)c(-n2cnnn2)c1 |
| InChI | InChI=1S/C13H18N6OS/c1-9-3-4-10(7-12(9)19-8-15-17-18-19)16-13(20)11(14)5-6-21-2/h3-4,7-8,11H,5-6,14H2,1-2H3,(H,16,20)/t11-/m0/s1 |
| InChIKey | MYTWSOCNVOKDPQ-NSHDSACASA-N |
| XLogP | 0.99 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |