C13H18ClN5OS — CID 119311201
(2S)-2-amino-4-methylsulfanyl-N-[4-(triazol-1-yl)phenyl]butanamide;hydrochloride (PubChem CID 119311201) has the molecular formula C13H18ClN5OS and a molecular weight of 327.84 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-N-[4-(triazol-1-yl)phenyl]butanamide;hydrochloride.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-N-[4-(triazol-1-yl)phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119311201 |
| Molecular Formula | C13H18ClN5OS |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-N-[4-(triazol-1-yl)phenyl]butanamide;hydrochloride |
| SMILES | CSCC[C@H](N)C(=O)Nc1ccc(-n2ccnn2)cc1.Cl |
| InChI | InChI=1S/C13H17N5OS.ClH/c1-20-9-6-12(14)13(19)16-10-2-4-11(5-3-10)18-8-7-15-17-18;/h2-5,7-8,12H,6,9,14H2,1H3,(H,16,19);1H/t12-;/m0./s1 |
| InChIKey | ZYMXLUULFVXBCU-YDALLXLXSA-N |
| XLogP | 1.71 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |