C13H21N3O3S2 — CID 104907564
(2R)-2-amino-N-[4-(ethylsulfonylamino)phenyl]-4-methylsulfanylbutanamide (PubChem CID 104907564) has the molecular formula C13H21N3O3S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is (2R)-2-amino-N-[4-(ethylsulfonylamino)phenyl]-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-[4-(ethylsulfonylamino)phenyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104907564 |
| Molecular Formula | C13H21N3O3S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (2R)-2-amino-N-[4-(ethylsulfonylamino)phenyl]-4-methylsulfanylbutanamide |
| SMILES | CCS(=O)(=O)Nc1ccc(NC(=O)[C@H](N)CCSC)cc1 |
| InChI | InChI=1S/C13H21N3O3S2/c1-3-21(18,19)16-11-6-4-10(5-7-11)15-13(17)12(14)8-9-20-2/h4-7,12,16H,3,8-9,14H2,1-2H3,(H,15,17)/t12-/m1/s1 |
| InChIKey | UCHPDQKXBXMPGG-GFCCVEGCSA-N |
| XLogP | 1.47 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |