C14H21N3O2S — CID 104907289
(2R)-2-amino-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]-4-methylsulfanylbutanamide (PubChem CID 104907289) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is (2R)-2-amino-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104907289 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (2R)-2-amino-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]-4-methylsulfanylbutanamide |
| SMILES | CNC(=O)Cc1ccc(NC(=O)[C@H](N)CCSC)cc1 |
| InChI | InChI=1S/C14H21N3O2S/c1-16-13(18)9-10-3-5-11(6-4-10)17-14(19)12(15)7-8-20-2/h3-6,12H,7-9,15H2,1-2H3,(H,16,18)(H,17,19)/t12-/m1/s1 |
| InChIKey | JECKYETUCOXSEB-GFCCVEGCSA-N |
| XLogP | 0.99 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |