C16H26N4O2S — CID 119868241
(2S)-2-amino-N-[4-[3-(dimethylamino)propanoylamino]phenyl]-4-methylsulfanylbutanamide (PubChem CID 119868241) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-[3-(dimethylamino)propanoylamino]phenyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[4-[3-(dimethylamino)propanoylamino]phenyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 119868241 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (2S)-2-amino-N-[4-[3-(dimethylamino)propanoylamino]phenyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)Nc1ccc(NC(=O)CCN(C)C)cc1 |
| InChI | InChI=1S/C16H26N4O2S/c1-20(2)10-8-15(21)18-12-4-6-13(7-5-12)19-16(22)14(17)9-11-23-3/h4-7,14H,8-11,17H2,1-3H3,(H,18,21)(H,19,22)/t14-/m0/s1 |
| InChIKey | XIPPRMSCPCKNCO-AWEZNQCLSA-N |
| XLogP | 1.60 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |