C14H21N3O3S — CID 104907269
ethyl N-[4-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]phenyl]carbamate (PubChem CID 104907269) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is ethyl N-[4-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]phenyl]carbamate.
| Compound Name | ethyl N-[4-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 104907269 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | ethyl N-[4-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NC(=O)[C@H](N)CCSC)cc1 |
| InChI | InChI=1S/C14H21N3O3S/c1-3-20-14(19)17-11-6-4-10(5-7-11)16-13(18)12(15)8-9-21-2/h4-7,12H,3,8-9,15H2,1-2H3,(H,16,18)(H,17,19)/t12-/m1/s1 |
| InChIKey | UNOWEEUQKCCIJA-GFCCVEGCSA-N |
| XLogP | 2.27 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |