C12H15F3N2O2S — CID 61149114
(2S)-2-amino-4-methylsulfanyl-N-[4-(trifluoromethoxy)phenyl]butanamide (PubChem CID 61149114) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.33 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-N-[4-(trifluoromethoxy)phenyl]butanamide.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-N-[4-(trifluoromethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 61149114 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-N-[4-(trifluoromethoxy)phenyl]butanamide |
| SMILES | CSCC[C@H](N)C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3N2O2S/c1-20-7-6-10(16)11(18)17-8-2-4-9(5-3-8)19-12(13,14)15/h2-5,10H,6-7,16H2,1H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | MFDZBWWCNSSSHQ-JTQLQIEISA-N |
| XLogP | 2.60 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |