C15H15N5O2 — CID 39224251
3-(furan-2-yl)-N-[4-methyl-3-(tetrazol-1-yl)phenyl]propanamide (PubChem CID 39224251) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[4-methyl-3-(tetrazol-1-yl)phenyl]propanamide.
| Compound Name | 3-(furan-2-yl)-N-[4-methyl-3-(tetrazol-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 39224251 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 3-(furan-2-yl)-N-[4-methyl-3-(tetrazol-1-yl)phenyl]propanamide |
| SMILES | Cc1ccc(NC(=O)CCc2ccco2)cc1-n1cnnn1 |
| InChI | InChI=1S/C15H15N5O2/c1-11-4-5-12(9-14(11)20-10-16-18-19-20)17-15(21)7-6-13-3-2-8-22-13/h2-5,8-10H,6-7H2,1H3,(H,17,21) |
| InChIKey | IGOMKMBYZBFCQM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |