C17H16FN5O — CID 134044042
3-(4-fluorophenyl)-N-[3-methyl-4-(tetrazol-1-yl)phenyl]propanamide (PubChem CID 134044042) has the molecular formula C17H16FN5O and a molecular weight of 325.35 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[3-methyl-4-(tetrazol-1-yl)phenyl]propanamide.
| Compound Name | 3-(4-fluorophenyl)-N-[3-methyl-4-(tetrazol-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 134044042 |
| Molecular Formula | C17H16FN5O |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[3-methyl-4-(tetrazol-1-yl)phenyl]propanamide |
| SMILES | Cc1cc(NC(=O)CCc2ccc(F)cc2)ccc1-n1cnnn1 |
| InChI | InChI=1S/C17H16FN5O/c1-12-10-15(7-8-16(12)23-11-19-21-22-23)20-17(24)9-4-13-2-5-14(18)6-3-13/h2-3,5-8,10-11H,4,9H2,1H3,(H,20,24) |
| InChIKey | MPMNSZUPTTWAAS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |