C22H18N6O3 — CID 103599504
N-[1-(furan-2-yl)-3-[4-methyl-3-(tetrazol-1-yl)anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 103599504) has the molecular formula C22H18N6O3 and a molecular weight of 414.43 g/mol. Its IUPAC name is N-[1-(furan-2-yl)-3-[4-methyl-3-(tetrazol-1-yl)anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(furan-2-yl)-3-[4-methyl-3-(tetrazol-1-yl)anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 103599504 |
| Molecular Formula | C22H18N6O3 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-[1-(furan-2-yl)-3-[4-methyl-3-(tetrazol-1-yl)anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(NC(=O)C(=Cc2ccco2)NC(=O)c2ccccc2)cc1-n1cnnn1 |
| InChI | InChI=1S/C22H18N6O3/c1-15-9-10-17(12-20(15)28-14-23-26-27-28)24-22(30)19(13-18-8-5-11-31-18)25-21(29)16-6-3-2-4-7-16/h2-14H,1H3,(H,24,30)(H,25,29) |
| InChIKey | GAVTTZPZNOKMAZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|