C15H17N6O3+ — CID 7437156
furan-2-ylmethyl-[2-[3-methoxy-4-(tetrazol-1-yl)anilino]-2-oxoethyl]azanium (PubChem CID 7437156) has the molecular formula C15H17N6O3+ and a molecular weight of 329.34 g/mol. Its IUPAC name is furan-2-ylmethyl-[2-[3-methoxy-4-(tetrazol-1-yl)anilino]-2-oxoethyl]azanium.
| Compound Name | furan-2-ylmethyl-[2-[3-methoxy-4-(tetrazol-1-yl)anilino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 7437156 |
| Molecular Formula | C15H17N6O3+ |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | furan-2-ylmethyl-[2-[3-methoxy-4-(tetrazol-1-yl)anilino]-2-oxoethyl]azanium |
| SMILES | COc1cc(NC(=O)C[NH2+]Cc2ccco2)ccc1-n1cnnn1 |
| InChI | InChI=1S/C15H16N6O3/c1-23-14-7-11(4-5-13(14)21-10-17-19-20-21)18-15(22)9-16-8-12-3-2-6-24-12/h2-7,10,16H,8-9H2,1H3,(H,18,22)/p+1 |
| InChIKey | KHZCLOKEWANONJ-UHFFFAOYSA-O |
| XLogP | -0.03 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |