C18H16N6O2 — CID 858417
2-(1H-indol-3-yl)-N-[3-methoxy-4-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 858417) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[3-methoxy-4-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | 2-(1H-indol-3-yl)-N-[3-methoxy-4-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 858417 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[3-methoxy-4-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | COc1cc(NC(=O)Cc2c[nH]c3ccccc23)ccc1-n1cnnn1 |
| InChI | InChI=1S/C18H16N6O2/c1-26-17-9-13(6-7-16(17)24-11-20-22-23-24)21-18(25)8-12-10-19-15-5-3-2-4-14(12)15/h2-7,9-11,19H,8H2,1H3,(H,21,25) |
| InChIKey | VIKCBFRDXNFXCY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |