C14H15NO4 — CID 110690712
N-(3,4-dimethoxyphenyl)-2-(furan-2-yl)acetamide (PubChem CID 110690712) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-(furan-2-yl)acetamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-(furan-2-yl)acetamide |
|---|---|
| PubChem CID | 110690712 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-(furan-2-yl)acetamide |
| SMILES | COc1ccc(NC(=O)Cc2ccco2)cc1OC |
| InChI | InChI=1S/C14H15NO4/c1-17-12-6-5-10(8-13(12)18-2)15-14(16)9-11-4-3-7-19-11/h3-8H,9H2,1-2H3,(H,15,16) |
| InChIKey | WHLANJFPRZZOBT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |