C17H24N6O3S — CID 51956219
(3S)-N-[4-methyl-3-(tetrazol-1-yl)phenyl]-1-propylsulfonylpiperidine-3-carboxamide (PubChem CID 51956219) has the molecular formula C17H24N6O3S and a molecular weight of 392.49 g/mol. Its IUPAC name is (3S)-N-[4-methyl-3-(tetrazol-1-yl)phenyl]-1-propylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[4-methyl-3-(tetrazol-1-yl)phenyl]-1-propylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 51956219 |
| Molecular Formula | C17H24N6O3S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (3S)-N-[4-methyl-3-(tetrazol-1-yl)phenyl]-1-propylsulfonylpiperidine-3-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCC[C@H](C(=O)Nc2ccc(C)c(-n3cnnn3)c2)C1 |
| InChI | InChI=1S/C17H24N6O3S/c1-3-9-27(25,26)22-8-4-5-14(11-22)17(24)19-15-7-6-13(2)16(10-15)23-12-18-20-21-23/h6-7,10,12,14H,3-5,8-9,11H2,1-2H3,(H,19,24)/t14-/m0/s1 |
| InChIKey | WRRZLBQLSPYVGT-AWEZNQCLSA-N |
| XLogP | 1.36 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |