C18H23N3O3S2 — CID 97275488
(3R)-1-propylsulfonyl-N-[4-(1,3-thiazol-4-yl)phenyl]piperidine-3-carboxamide (PubChem CID 97275488) has the molecular formula C18H23N3O3S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is (3R)-1-propylsulfonyl-N-[4-(1,3-thiazol-4-yl)phenyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-propylsulfonyl-N-[4-(1,3-thiazol-4-yl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97275488 |
| Molecular Formula | C18H23N3O3S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | (3R)-1-propylsulfonyl-N-[4-(1,3-thiazol-4-yl)phenyl]piperidine-3-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCC[C@@H](C(=O)Nc2ccc(-c3cscn3)cc2)C1 |
| InChI | InChI=1S/C18H23N3O3S2/c1-2-10-26(23,24)21-9-3-4-15(11-21)18(22)20-16-7-5-14(6-8-16)17-12-25-13-19-17/h5-8,12-13,15H,2-4,9-11H2,1H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | YWINOWXUANIMDF-OAHLLOKOSA-N |
| XLogP | 3.20 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |