C16H19N3O3S2 — CID 72881399
1-methylsulfonyl-N-[4-(1,3-thiazol-4-yl)phenyl]piperidine-3-carboxamide (PubChem CID 72881399) has the molecular formula C16H19N3O3S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[4-(1,3-thiazol-4-yl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-methylsulfonyl-N-[4-(1,3-thiazol-4-yl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 72881399 |
| Molecular Formula | C16H19N3O3S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 1-methylsulfonyl-N-[4-(1,3-thiazol-4-yl)phenyl]piperidine-3-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC(C(=O)Nc2ccc(-c3cscn3)cc2)C1 |
| InChI | InChI=1S/C16H19N3O3S2/c1-24(21,22)19-8-2-3-13(9-19)16(20)18-14-6-4-12(5-7-14)15-10-23-11-17-15/h4-7,10-11,13H,2-3,8-9H2,1H3,(H,18,20) |
| InChIKey | JRVPATPCEFXQOJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |