C19H25N3OS2 — CID 45220934
1-(3-methylsulfanylpropyl)-N-[4-(1,3-thiazol-4-yl)phenyl]piperidine-3-carboxamide (PubChem CID 45220934) has the molecular formula C19H25N3OS2 and a molecular weight of 375.56 g/mol. Its IUPAC name is 1-(3-methylsulfanylpropyl)-N-[4-(1,3-thiazol-4-yl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-(3-methylsulfanylpropyl)-N-[4-(1,3-thiazol-4-yl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45220934 |
| Molecular Formula | C19H25N3OS2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 1-(3-methylsulfanylpropyl)-N-[4-(1,3-thiazol-4-yl)phenyl]piperidine-3-carboxamide |
| SMILES | CSCCCN1CCCC(C(=O)Nc2ccc(-c3cscn3)cc2)C1 |
| InChI | InChI=1S/C19H25N3OS2/c1-24-11-3-10-22-9-2-4-16(12-22)19(23)21-17-7-5-15(6-8-17)18-13-25-14-20-18/h5-8,13-14,16H,2-4,9-12H2,1H3,(H,21,23) |
| InChIKey | WTRXZRBFLYHIMG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|