C20H26N2O2S — CID 42191121
(3R)-N-[4-(furan-2-yl)phenyl]-1-(3-methylsulfanylpropyl)piperidine-3-carboxamide (PubChem CID 42191121) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is (3R)-N-[4-(furan-2-yl)phenyl]-1-(3-methylsulfanylpropyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[4-(furan-2-yl)phenyl]-1-(3-methylsulfanylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42191121 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | (3R)-N-[4-(furan-2-yl)phenyl]-1-(3-methylsulfanylpropyl)piperidine-3-carboxamide |
| SMILES | CSCCCN1CCC[C@@H](C(=O)Nc2ccc(-c3ccco3)cc2)C1 |
| InChI | InChI=1S/C20H26N2O2S/c1-25-14-4-12-22-11-2-5-17(15-22)20(23)21-18-9-7-16(8-10-18)19-6-3-13-24-19/h3,6-10,13,17H,2,4-5,11-12,14-15H2,1H3,(H,21,23)/t17-/m1/s1 |
| InChIKey | UVMHFIXWSRQXQV-QGZVFWFLSA-N |
| XLogP | 4.35 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|