C24H22N2O4 — CID 42348707
(3R)-N-[4-(furan-2-yl)phenyl]-1-(2-oxo-2-phenylacetyl)piperidine-3-carboxamide (PubChem CID 42348707) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is (3R)-N-[4-(furan-2-yl)phenyl]-1-(2-oxo-2-phenylacetyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[4-(furan-2-yl)phenyl]-1-(2-oxo-2-phenylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42348707 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (3R)-N-[4-(furan-2-yl)phenyl]-1-(2-oxo-2-phenylacetyl)piperidine-3-carboxamide |
| SMILES | O=C(C(=O)N1CCC[C@@H](C(=O)Nc2ccc(-c3ccco3)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C24H22N2O4/c27-22(18-6-2-1-3-7-18)24(29)26-14-4-8-19(16-26)23(28)25-20-12-10-17(11-13-20)21-9-5-15-30-21/h1-3,5-7,9-13,15,19H,4,8,14,16H2,(H,25,28)/t19-/m1/s1 |
| InChIKey | PHZLMBNUCZTMTH-LJQANCHMSA-N |
| XLogP | 4.01 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|