C24H24N4O4 — CID 42935667
3-N-[3-(furan-2-carbonylamino)phenyl]-1-N-phenylpiperidine-1,3-dicarboxamide (PubChem CID 42935667) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 3-N-[3-(furan-2-carbonylamino)phenyl]-1-N-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-[3-(furan-2-carbonylamino)phenyl]-1-N-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 42935667 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 3-N-[3-(furan-2-carbonylamino)phenyl]-1-N-phenylpiperidine-1,3-dicarboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)C2CCCN(C(=O)Nc3ccccc3)C2)c1)c1ccco1 |
| InChI | InChI=1S/C24H24N4O4/c29-22(17-7-5-13-28(16-17)24(31)27-18-8-2-1-3-9-18)25-19-10-4-11-20(15-19)26-23(30)21-12-6-14-32-21/h1-4,6,8-12,14-15,17H,5,7,13,16H2,(H,25,29)(H,26,30)(H,27,31) |
| InChIKey | CDYMVLMYHNXBST-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |