C16H13BrN2S — CID 60936182
N-[(4-bromophenyl)methyl]-3-(1,3-thiazol-2-yl)aniline (PubChem CID 60936182) has the molecular formula C16H13BrN2S and a molecular weight of 345.27 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-3-(1,3-thiazol-2-yl)aniline.
| Compound Name | N-[(4-bromophenyl)methyl]-3-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 60936182 |
| Molecular Formula | C16H13BrN2S |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-3-(1,3-thiazol-2-yl)aniline |
| SMILES | Brc1ccc(CNc2cccc(-c3nccs3)c2)cc1 |
| InChI | InChI=1S/C16H13BrN2S/c17-14-6-4-12(5-7-14)11-19-15-3-1-2-13(10-15)16-18-8-9-20-16/h1-10,19H,11H2 |
| InChIKey | XDBYBZXOXOLRBM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |