C18H18N2S — CID 60694542
N-[(3,5-dimethylphenyl)methyl]-4-(1,3-thiazol-2-yl)aniline (PubChem CID 60694542) has the molecular formula C18H18N2S and a molecular weight of 294.42 g/mol. Its IUPAC name is N-[(3,5-dimethylphenyl)methyl]-4-(1,3-thiazol-2-yl)aniline.
| Compound Name | N-[(3,5-dimethylphenyl)methyl]-4-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 60694542 |
| Molecular Formula | C18H18N2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-[(3,5-dimethylphenyl)methyl]-4-(1,3-thiazol-2-yl)aniline |
| SMILES | Cc1cc(C)cc(CNc2ccc(-c3nccs3)cc2)c1 |
| InChI | InChI=1S/C18H18N2S/c1-13-9-14(2)11-15(10-13)12-20-17-5-3-16(4-6-17)18-19-7-8-21-18/h3-11,20H,12H2,1-2H3 |
| InChIKey | JDIIALUSPLTIAI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |