C13H16N2O2S — CID 63696540
N-(2,2-dimethoxyethyl)-4-(1,3-thiazol-2-yl)aniline (PubChem CID 63696540) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-4-(1,3-thiazol-2-yl)aniline.
| Compound Name | N-(2,2-dimethoxyethyl)-4-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 63696540 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-4-(1,3-thiazol-2-yl)aniline |
| SMILES | COC(CNc1ccc(-c2nccs2)cc1)OC |
| InChI | InChI=1S/C13H16N2O2S/c1-16-12(17-2)9-15-11-5-3-10(4-6-11)13-14-7-8-18-13/h3-8,12,15H,9H2,1-2H3 |
| InChIKey | YOZWNLKELOAQPB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|