C14H12N4S — CID 62749085
N-(pyrimidin-4-ylmethyl)-4-(1,3-thiazol-2-yl)aniline (PubChem CID 62749085) has the molecular formula C14H12N4S and a molecular weight of 268.35 g/mol. Its IUPAC name is N-(pyrimidin-4-ylmethyl)-4-(1,3-thiazol-2-yl)aniline.
| Compound Name | N-(pyrimidin-4-ylmethyl)-4-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 62749085 |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-(pyrimidin-4-ylmethyl)-4-(1,3-thiazol-2-yl)aniline |
| SMILES | c1cc(CNc2ccc(-c3nccs3)cc2)ncn1 |
| InChI | InChI=1S/C14H12N4S/c1-3-12(17-9-13-5-6-15-10-18-13)4-2-11(1)14-16-7-8-19-14/h1-8,10,17H,9H2 |
| InChIKey | GAWXPISZLLQJEN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |