C16H14N2OS — CID 60927719
2-[[4-(1,3-thiazol-2-yl)anilino]methyl]phenol (PubChem CID 60927719) has the molecular formula C16H14N2OS and a molecular weight of 282.37 g/mol. Its IUPAC name is 2-[[4-(1,3-thiazol-2-yl)anilino]methyl]phenol.
| Compound Name | 2-[[4-(1,3-thiazol-2-yl)anilino]methyl]phenol |
|---|---|
| PubChem CID | 60927719 |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-[[4-(1,3-thiazol-2-yl)anilino]methyl]phenol |
| SMILES | Oc1ccccc1CNc1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C16H14N2OS/c19-15-4-2-1-3-13(15)11-18-14-7-5-12(6-8-14)16-17-9-10-20-16/h1-10,18-19H,11H2 |
| InChIKey | WJZDRSGVOSIPFN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|